EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N3O2 |
| Net Charge | 0 |
| Average Mass | 395.547 |
| Monoisotopic Mass | 395.25728 |
| SMILES | OC(COc1ccc(C2CCCCC2)cc1)CN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H33N3O2/c28-22(18-26-14-16-27(17-15-26)24-8-4-5-13-25-24)19-29-23-11-9-21(10-12-23)20-6-2-1-3-7-20/h4-5,8-13,20,22,28H,1-3,6-7,14-19H2 |
| InChIKey | BZJHCQBNFUNZPJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SDZ 35-682 (CHEBI:45666) has functional parent glycerol (CHEBI:17754) |
| SDZ 35-682 (CHEBI:45666) has role antiviral agent (CHEBI:22587) |
| SDZ 35-682 (CHEBI:45666) is a N-alkylpiperazine (CHEBI:46845) |
| SDZ 35-682 (CHEBI:45666) is a N-arylpiperazine (CHEBI:46848) |
| SDZ 35-682 (CHEBI:45666) is a aminopyridine (CHEBI:38207) |
| SDZ 35-682 (CHEBI:45666) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| 1-(4-cyclohexylphenoxy)-3-[4-(pyridin-2-yl)piperazin-1-yl]propan-2-ol |
| Synonym | Source |
|---|---|
| 1-[2-HYDROXY-3-(4-CYCLOHEXYL-PHENOXY)-PROPYL]-4-(2-PYRIDYL)-PIPERAZINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| SDZ | PDBeChem |
| Citations |
|---|