EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O8P2 |
| Net Charge | 0 |
| Average Mass | 428.314 |
| Monoisotopic Mass | 428.07899 |
| SMILES | CC/C(=C(/CC)c1ccc(OP(=O)(O)O)cc1)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C18H22O8P2/c1-3-17(13-5-9-15(10-6-13)25-27(19,20)21)18(4-2)14-7-11-16(12-8-14)26-28(22,23)24/h5-12H,3-4H2,1-2H3,(H2,19,20,21)(H2,22,23,24)/b18-17+ |
| InChIKey | NLORYLAYLIXTID-ISLYRVAYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylstilbestrol diphosphate (CHEBI:4532) has functional parent diethylstilbestrol (CHEBI:41922) |
| diethylstilbestrol diphosphate (CHEBI:4532) has role antineoplastic agent (CHEBI:35610) |
| diethylstilbestrol diphosphate (CHEBI:4532) is a aryl phosphate (CHEBI:36943) |
| Synonyms | Source |
|---|---|
| diethyldihydroxystilbene diphosphate | DrugCentral |
| diethylstilbesterol bisphosphate | DrugCentral |
| diethylstilbesterol diphosphate | DrugCentral |
| Diethylstilbestrol bisphosphate | KEGG COMPOUND |
| diethylstilbestrol diphosphate | DrugCentral |
| Diethylstilbestrol diphosphate | KEGG COMPOUND |
| Citations |
|---|