EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:41922 - diethylstilbestrol
| Formula | C18H20O2 |
| Net Charge | 0 |
| Average Mass | 268.356 |
| Monoisotopic Mass | 268.14633 |
| SMILES | CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17+ |
| InChIKey | RGLYKWWBQGJZGM-ISLYRVAYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of 11β-hydroxysteroid dehydrogenase (EC 1.1.1.146). calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylstilbestrol (CHEBI:41922) has role antifungal agent (CHEBI:35718) |
| diethylstilbestrol (CHEBI:41922) has role antineoplastic agent (CHEBI:35610) |
| diethylstilbestrol (CHEBI:41922) has role autophagy inducer (CHEBI:138880) |
| diethylstilbestrol (CHEBI:41922) has role calcium channel blocker (CHEBI:38215) |
| diethylstilbestrol (CHEBI:41922) has role carcinogenic agent (CHEBI:50903) |
| diethylstilbestrol (CHEBI:41922) has role EC 1.1.1.146 (11β-hydroxysteroid dehydrogenase) inhibitor (CHEBI:137626) |
| diethylstilbestrol (CHEBI:41922) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| diethylstilbestrol (CHEBI:41922) has role endocrine disruptor (CHEBI:138015) |
| diethylstilbestrol (CHEBI:41922) has role xenoestrogen (CHEBI:76988) |
| diethylstilbestrol (CHEBI:41922) is a olefinic compound (CHEBI:78840) |
| diethylstilbestrol (CHEBI:41922) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| diethylstilbestrol diphosphate (CHEBI:4532) has functional parent diethylstilbestrol (CHEBI:41922) |
| IUPAC Name |
|---|
| 4,4'-(3E)-hex-3-ene-3,4-diyldiphenol |
| INNs | Source |
|---|---|
| diethylstilbestrol | ChemIDplus |
| diéthylstilbestrol | ChEBI |
| diethylstilbestrolum | ChemIDplus |
| dietilestilbestrol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4,4'-dihydroxy-α,β-diethylstilbene | NIST Chemistry WebBook |
| DES | KEGG COMPOUND |
| Diethylstilbestrol | KEGG COMPOUND |
| (E)-3,4-bis(4-hydroxyphenyl)-3-hexene | ChemIDplus |
| (E)-4,4'-(1,2-diethyl-1,2-ethenediyl)bisphenol | NIST Chemistry WebBook |
| trans-4,4'-(1,2-diethyl-1,2-ethenediyl)bisphenol | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Distilbene | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 875 | DrugCentral |
| C07620 | KEGG COMPOUND |
| D00577 | KEGG DRUG |
| DB00255 | DrugBank |
| DES | PDBeChem |
| Diethylstilbestrol | Wikipedia |
| FDB007498 | FooDB |
| HMDB0014400 | HMDB |
| Citations |
|---|