EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO2 |
| Net Charge | 0 |
| Average Mass | 207.273 |
| Monoisotopic Mass | 207.12593 |
| SMILES | Cc1cc(C2CCCCC2)n(O)c(=O)c1 |
| InChI | InChI=1S/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3 |
| InChIKey | SCKYRAXSEDYPSA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | antiseborrheic A drug or agent applied to the skin to control seborrhea or seborrheic dermatitis. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciclopirox (CHEBI:453011) has role antibacterial agent (CHEBI:33282) |
| ciclopirox (CHEBI:453011) has role antiseborrheic (CHEBI:59010) |
| ciclopirox (CHEBI:453011) is a cyclic hydroxamic acid (CHEBI:23445) |
| ciclopirox (CHEBI:453011) is a hydroxypyridone antifungal drug (CHEBI:87130) |
| ciclopirox (CHEBI:453011) is a pyridone (CHEBI:38183) |
| Incoming Relation(s) |
| ciclopirox olamine (CHEBI:31398) has part ciclopirox (CHEBI:453011) |
| IUPAC Name |
|---|
| 6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one |
| INNs | Source |
|---|---|
| ciclopirox | WHO MedNet |
| ciclopirox | WHO MedNet |
| ciclopirox | ChemIDplus |
| ciclopiroxum | ChemIDplus |
| Synonym | Source |
|---|---|
| 6-cyclohexyl-1-hydroxy-4-methyl-2(1H)-pyridinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1533423 | Beilstein |
| CAS:29342-05-0 | ChemIDplus |
| Citations |
|---|