EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16NO2.C2H8NO |
| Net Charge | 0 |
| Average Mass | 268.357 |
| Monoisotopic Mass | 268.17869 |
| SMILES | Cc1cc(C2CCCCC2)n([O-])c(=O)c1.[NH3+]CCO |
| InChI | InChI=1S/C12H16NO2.C2H7NO/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10H,2-6H2,1H3;4H,1-3H2/q-1;/p+1 |
| InChIKey | HKUKJIQHPXYJTP-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antiseborrheic A drug or agent applied to the skin to control seborrhea or seborrheic dermatitis. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciclopirox olamine (CHEBI:31398) has part ciclopirox (CHEBI:453011) |
| ciclopirox olamine (CHEBI:31398) has part ethanolaminium(1+) (CHEBI:57603) |
| ciclopirox olamine (CHEBI:31398) has role antibacterial agent (CHEBI:33282) |
| ciclopirox olamine (CHEBI:31398) has role antiseborrheic (CHEBI:59010) |
| ciclopirox olamine (CHEBI:31398) has role ferroptosis inhibitor (CHEBI:173084) |
| ciclopirox olamine (CHEBI:31398) has role geroprotector (CHEBI:176497) |
| ciclopirox olamine (CHEBI:31398) is a hydroxypyridone antifungal drug (CHEBI:87130) |
| ciclopirox olamine (CHEBI:31398) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| 2-hydroxyethanaminium 6-cyclohexyl-4-methyl-2-oxopyridin-1(2H)-olate |
| Synonyms | Source |
|---|---|
| ciclopirox ethanolamine salt | ChemIDplus |
| HOE-296 | DrugBank |
| HOE 296 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Loprox | ChemIDplus |
| Mycoster | ChemIDplus |
| Micoxolamina | ChemIDplus |
| Brumixol | ChemIDplus |
| Batrafen | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01364 | KEGG DRUG |
| DBSALT001147 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6494273 | Beilstein |
| CAS:41621-49-2 | KEGG DRUG |
| CAS:41621-49-2 | ChemIDplus |
| Citations |
|---|