EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H20N4O2 |
| Net Charge | 0 |
| Average Mass | 408.461 |
| Monoisotopic Mass | 408.15863 |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2cc3ccccc3n2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H20N4O2/c1-29-21-14-8-6-12-18(21)22(16-9-3-2-4-10-16)27-23(25(29)31)28-24(30)20-15-17-11-5-7-13-19(17)26-20/h2-15,23,26H,1H3,(H,28,30)/t23-/m1/s1 |
| InChIKey | NFHRQQKPEBFUJK-HSZRJFAPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| devazepide (CHEBI:4460) has role antineoplastic agent (CHEBI:35610) |
| devazepide (CHEBI:4460) has role apoptosis inducer (CHEBI:68495) |
| devazepide (CHEBI:4460) has role cholecystokinin antagonist (CHEBI:73296) |
| devazepide (CHEBI:4460) has role gastrointestinal drug (CHEBI:55324) |
| devazepide (CHEBI:4460) is a 1,4-benzodiazepinone (CHEBI:35500) |
| devazepide (CHEBI:4460) is a indolecarboxamide (CHEBI:46921) |
| IUPAC Name |
|---|
| N-[(3S)-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]-1H-indole-2-carboxamide |
| INNs | Source |
|---|---|
| devazepide | KEGG DRUG |
| devazepidum | ChemIDplus |
| devazepida | ChemIDplus |
| Synonyms | Source |
|---|---|
| MK-329 | KEGG COMPOUND |
| L 364718 | KEGG DRUG |
| (S)-N-(2,3-Dihydro-1-methyl-2-oxo-5-phenyl-1H-1,4-benzodiazepin-3-yl)indole-2-carboxamide | ChemIDplus |
| 3(S)-(-)-1,3-Dihydro-3-(2-indolecarbonylamino)-1-methyl-5-phenyl-2H-(1,4)benzodiazepin-2-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11710 | KEGG COMPOUND |
| D02693 | KEGG DRUG |
| US5428031 | Patent |
| US5153191 | Patent |
| US2003139396 | Patent |
| US2003153592 | Patent |
| US4820834 | Patent |
| Devazepide | Wikipedia |
| LSM-2674 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5156082 | Reaxys |
| CAS:103420-77-5 | KEGG COMPOUND |
| CAS:103420-77-5 | ChemIDplus |
| Citations |
|---|