EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O4 |
| Net Charge | 0 |
| Average Mass | 296.322 |
| Monoisotopic Mass | 296.10486 |
| SMILES | C[C@]12OO[C@](CCC(=O)O)(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C18H16O4/c1-17-12-6-2-4-8-14(12)18(22-21-17,11-10-16(19)20)15-9-5-3-7-13(15)17/h2-9H,10-11H2,1H3,(H,19,20)/t17-,18+ |
| InChIKey | IOWYALZFEJOVHO-HDICACEKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(2-carboxyethyl)-10-methylanthracene endoperoxide (CHEBI:44592) has role hapten (CHEBI:59174) |
| 9-(2-carboxyethyl)-10-methylanthracene endoperoxide (CHEBI:44592) is a anthracenes (CHEBI:46955) |
| 9-(2-carboxyethyl)-10-methylanthracene endoperoxide (CHEBI:44592) is a monocarboxylic acid (CHEBI:25384) |
| 9-(2-carboxyethyl)-10-methylanthracene endoperoxide (CHEBI:44592) is a organic peroxide (CHEBI:25702) |
| IUPAC Name |
|---|
| 3-(10-methyl-9,10-epidioxyanthracen-9(10H)-yl)propanoic acid |
| Synonym | Source |
|---|---|
| [2'-CARBOXYLETHYL]-10-METHYL-ANTHRACENE ENDOPEROXIDE | PDBeChem |
| Citations |
|---|