EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO6 |
| Net Charge | 0 |
| Average Mass | 191.139 |
| Monoisotopic Mass | 191.04299 |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | MGFYIUFZLHCRTH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrilotriacetic acid (CHEBI:44557) has role carcinogenic agent (CHEBI:50903) |
| nitrilotriacetic acid (CHEBI:44557) has role nephrotoxic agent (CHEBI:50909) |
| nitrilotriacetic acid (CHEBI:44557) is a NTA (CHEBI:39054) |
| nitrilotriacetic acid (CHEBI:44557) is a tricarboxylic acid (CHEBI:27093) |
| nitrilotriacetic acid (CHEBI:44557) is conjugate acid of nitrilotriacetate(1−) (CHEBI:39053) |
| Incoming Relation(s) |
| 2,2'-[(2-amino-2-oxoethyl)imino]diacetic acid (CHEBI:43960) has functional parent nitrilotriacetic acid (CHEBI:44557) |
| nitrilotriacetate(1−) (CHEBI:39053) is conjugate base of nitrilotriacetic acid (CHEBI:44557) |
| IUPAC Name |
|---|
| N,N-bis(carboxymethyl)glycine |
| Synonyms | Source |
|---|---|
| Complexon I | ChEBI |
| H3nta | IUPAC |
| Komplexon I | ChEBI |
| N(CH2‒COOH)3 | IUPAC |
| nitrilo-2,2',2''-triacetic acid | ChemIDplus |
| Nitrilotriacetate | KEGG COMPOUND |