EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8NO6 |
| Net Charge | -1 |
| Average Mass | 190.131 |
| Monoisotopic Mass | 190.03571 |
| SMILES | O=C([O-])CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)/p-1 |
| InChIKey | MGFYIUFZLHCRTH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrilotriacetate(1−) (CHEBI:39053) is a NTA (CHEBI:39054) |
| nitrilotriacetate(1−) (CHEBI:39053) is a tricarboxylic acid monoanion (CHEBI:36299) |
| nitrilotriacetate(1−) (CHEBI:39053) is conjugate acid of nitrilotriacetate(2−) (CHEBI:39056) |
| nitrilotriacetate(1−) (CHEBI:39053) is conjugate base of nitrilotriacetic acid (CHEBI:44557) |
| Incoming Relation(s) |
| nitrilotriacetic acid (CHEBI:44557) is conjugate acid of nitrilotriacetate(1−) (CHEBI:39053) |
| nitrilotriacetate(2−) (CHEBI:39056) is conjugate base of nitrilotriacetate(1−) (CHEBI:39053) |
| IUPAC Names |
|---|
| [bis(carboxymethyl)amino]acetate |
| dihydrogen 2,2',2''-nitrilotriacetate |
| Synonym | Source |
|---|---|
| H2nta− | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6480945 | Beilstein |