EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO4 |
| Net Charge | 0 |
| Average Mass | 297.395 |
| Monoisotopic Mass | 297.19401 |
| SMILES | CCCCCCCCCC(=O)CC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C16H27NO4/c1-2-3-4-5-6-7-8-9-13(18)12-15(19)17-14-10-11-21-16(14)20/h14H,2-12H2,1H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | PHSRRHGYXQCRPU-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | - | PubMed (10556916) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-oxododecanoyl)-L-homoserine lactone (CHEBI:44534) has role bacterial metabolite (CHEBI:76969) |
| N-(3-oxododecanoyl)-L-homoserine lactone (CHEBI:44534) is a N-(3-oxododecanoyl)homoserine lactone (CHEBI:29639) |
| N-(3-oxododecanoyl)-L-homoserine lactone (CHEBI:44534) is a N-acyl-L-homoserine lactone (CHEBI:55474) |
| N-(3-oxododecanoyl)-L-homoserine lactone (CHEBI:44534) is enantiomer of N-(3-oxododecanoyl)-D-homoserine lactone (CHEBI:56080) |
| Incoming Relation(s) |
| N-(3-oxododecanoyl)-D-homoserine lactone (CHEBI:56080) is enantiomer of N-(3-oxododecanoyl)-L-homoserine lactone (CHEBI:44534) |
| IUPAC Name |
|---|
| 3-oxo-N-[(3S)-2-oxotetrahydrofuran-3-yl]dodecanamide |
| Synonyms | Source |
|---|---|
| 3-oxo-C12-AHL | ChEBI |
| 3-oxo-C12-HSL | ChEBI |
| N-(3-ketododecanoyl)-L-homoserine lactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA08030001 | LIPID MAPS |
| OHN | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7485197 | Reaxys |
| Citations |
|---|