EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29639 - N-(3-oxododecanoyl)homoserine lactone
| Formula | C16H27NO4 |
| Net Charge | 0 |
| Average Mass | 297.395 |
| Monoisotopic Mass | 297.19401 |
| SMILES | CCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
| InChI | InChI=1S/C16H27NO4/c1-2-3-4-5-6-7-8-9-13(18)12-15(19)17-14-10-11-21-16(14)20/h14H,2-12H2,1H3,(H,17,19) |
| InChIKey | PHSRRHGYXQCRPU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-oxododecanoyl)homoserine lactone (CHEBI:29639) is a N-acyl homoserine lactone (CHEBI:83169) |
| Incoming Relation(s) |
| N-(3-oxododecanoyl)-D-homoserine lactone (CHEBI:56080) is a N-(3-oxododecanoyl)homoserine lactone (CHEBI:29639) |
| N-(3-oxododecanoyl)-L-homoserine lactone (CHEBI:44534) is a N-(3-oxododecanoyl)homoserine lactone (CHEBI:29639) |
| IUPAC Name |
|---|
| 3-oxo-N-(2-oxotetrahydrofuran-3-yl)dodecanamide |
| Synonyms | Source |
|---|---|
| N-(3-Oxododecanoyl)homoserine lactone | KEGG COMPOUND |
| 3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)dodecanamide | ChemIDplus |
| Pseudomonas aeruginosa autoinducer | ChemIDplus |
| PA Autoinducer | ChemIDplus |
| N-(3-ketododecanoyl)homoserine lactone | ChEBI |
| 3-oxo-C12-HSL | ChEBI |
| UniProt Name | Source |
|---|---|
| N-(3-oxododecanoyl)homoserine lactone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11840 | KEGG COMPOUND |
| LMFA08030001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10100143 | Reaxys |
| CAS:152833-54-0 | KEGG COMPOUND |
| CAS:152833-54-0 | ChemIDplus |
| Citations |
|---|