EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C18H22N2.Cl |
| Net Charge | 0 |
| Average Mass | 302.849 |
| Monoisotopic Mass | 302.15498 |
| SMILES | CNCCCN1c2ccccc2CCc2ccccc21.[Cl-].[H+] |
| InChI | InChI=1S/C18H22N2.ClH/c1-19-13-6-14-20-17-9-4-2-7-15(17)11-12-16-8-3-5-10-18(16)20;/h2-5,7-10,19H,6,11-14H2,1H3;1H |
| InChIKey | XAEWZDYWZHIUCT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desipramine hydrochloride (CHEBI:4449) has part desipramine (CHEBI:47781) |
| desipramine hydrochloride (CHEBI:4449) has role drug allergen (CHEBI:88188) |
| desipramine hydrochloride (CHEBI:4449) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N-methylpropan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 10,11-Dihydro-5-(3-(methylamino)propyl)-5H-dibenz(b,f)azepine hydrochloride | ChemIDplus |
| 10,11-Dihydro-5-(3-(methylamino)propyl)-5H-dibenz(b,f)azepine monohydrochloride | ChemIDplus |
| DMI hydrochloride | ChemIDplus |
| Demethylimipramine hydrochloride | ChemIDplus |
| Desimipramine, hydrochloride | ChemIDplus |
| Desipramine HCl | ChemIDplus |
| Citations |
|---|