EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44445 - nimesulide
| Formula | C13H12N2O5S |
| Net Charge | 0 |
| Average Mass | 308.315 |
| Monoisotopic Mass | 308.04669 |
| SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1Oc1ccccc1 |
| InChI | InChI=1S/C13H12N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h2-9,14H,1H3 |
| InChIKey | HYWYRSMBCFDLJT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimesulide (CHEBI:44445) has functional parent nitrobenzene (CHEBI:27798) |
| nimesulide (CHEBI:44445) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| nimesulide (CHEBI:44445) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| nimesulide (CHEBI:44445) is a C-nitro compound (CHEBI:35716) |
| nimesulide (CHEBI:44445) is a aromatic ether (CHEBI:35618) |
| nimesulide (CHEBI:44445) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-(4-nitro-2-phenoxyphenyl)methanesulfonamide |
| Synonyms | Source |
|---|---|
| Nimesulide | KEGG DRUG |
| 4'-nitro-2'-phenoxymethanesulfonanilide | ChemIDplus |
| 4-NITRO-2-PHENOXYMETHANESULFONANILIDE | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2421175 | Beilstein |
| Reaxys:2421175 | Reaxys |
| CAS:51803-78-2 | ChemIDplus |
| Citations |
|---|