EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20NO4 |
| Net Charge | +1 |
| Average Mass | 338.383 |
| Monoisotopic Mass | 338.13868 |
| SMILES | [H][C@@]12Cc3ccc4c(c3C[N@+]1(C)CCc1cc3c(cc12)OCO3)OCO4 |
| InChI | InChI=1S/C20H20NO4/c1-21-5-4-13-7-18-19(24-10-23-18)8-14(13)16(21)6-12-2-3-17-20(15(12)9-21)25-11-22-17/h2-3,7-8,16H,4-6,9-11H2,1H3/q+1/t16-,21-/m0/s1 |
| InChIKey | GBUUKFRQPCPYPW-KKSFZXQISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-cis-N-methylstylopine (CHEBI:444) has functional parent (S)-stylopine (CHEBI:18285) |
| (S)-cis-N-methylstylopine (CHEBI:444) is a an (S)-cis-N-methyl-7,8,13,14-tetrahydroprotoberberine (CHEBI:194529) |
| (S)-cis-N-methylstylopine (CHEBI:444) is a berberine alkaloid (CHEBI:22754) |
| (S)-cis-N-methylstylopine (CHEBI:444) is a organic heterohexacyclic compound (CHEBI:51914) |
| (S)-cis-N-methylstylopine (CHEBI:444) is a quaternary ammonium ion (CHEBI:35267) |
| IUPAC Name |
|---|
| (5S,12bS)-5-methyl-6,7,12b,13-tetrahydro-4H-[1,3]dioxolo[4,5-g][1,3]dioxolo[7,8]isoquino[3,2-a]isoquinolin-5-ium |
| Synonym | Source |
|---|---|
| (S)-cis-N-methylstylopine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (S)-cis-N-methylstylopine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C06163 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4723082 | Beilstein |