EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CN[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C6H13NO2/c1-4(2)5(7-3)6(8)9/h4-5,7H,1-3H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | AKCRVYNORCOYQT-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-L-valine (CHEBI:44212) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| N-methyl-L-valine (CHEBI:44212) is a N-methylvaline (CHEBI:64348) |
| Incoming Relation(s) |
| cryptomaldamide (CHEBI:156424) has functional parent N-methyl-L-valine (CHEBI:44212) |
| IUPAC Name |
|---|
| N-methyl-L-valine |
| Synonyms | Source |
|---|---|
| (2S)-3-methyl-2-(methylamino)butanoic acid | PDBeChem |
| N-methylvaline | ChEBI |
| MaVal | ChEBI |
| methylvaline | NIST Chemistry WebBook |
| Citations |
|---|