EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33N5O5 |
| Net Charge | 0 |
| Average Mass | 399.492 |
| Monoisotopic Mass | 399.24817 |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H](CO)N=C(N)N)C(C)C)C(=O)O |
| InChI | InChI=1S/C18H33N5O5/c1-9(2)13(7-11(5)17(27)28)23(6)16(26)14(10(3)4)22-15(25)12(8-24)21-18(19)20/h7,9-10,12-14,24H,8H2,1-6H3,(H,22,25)(H,27,28)(H4,19,20,21)/b11-7+/t12-,13+,14-/m0/s1 |
| InChIKey | FUCBQNSQRCPSGC-BOUYHWOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moorea producens (ncbitaxon:1155739) | - | PubMed (28448144) | Strain: JHB |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptomaldamide (CHEBI:156424) has functional parent N-methyl-L-valine (CHEBI:44212) |
| cryptomaldamide (CHEBI:156424) has functional parent L-serine (CHEBI:17115) |
| cryptomaldamide (CHEBI:156424) has functional parent L-valine (CHEBI:16414) |
| cryptomaldamide (CHEBI:156424) has part guanidino group (CHEBI:48551) |
| cryptomaldamide (CHEBI:156424) has role bacterial metabolite (CHEBI:76969) |
| cryptomaldamide (CHEBI:156424) has role marine metabolite (CHEBI:76507) |
| cryptomaldamide (CHEBI:156424) is a tripeptide (CHEBI:47923) |
| Citations |
|---|