EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N2O2 |
| Net Charge | 0 |
| Average Mass | 174.244 |
| Monoisotopic Mass | 174.13683 |
| SMILES | CN(C)CCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H18N2O2/c1-10(2)6-4-3-5-7(9)8(11)12/h7H,3-6,9H2,1-2H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | XXEWFEBMSGLYBY-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6,N6-dimethyl-L-lysine (CHEBI:43997) is a L-lysine derivative (CHEBI:25095) |
| N6,N6-dimethyl-L-lysine (CHEBI:43997) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| N6,N6-dimethyl-L-lysine (CHEBI:43997) is conjugate base of N6,N6-dimethyl-L-lysinium (CHEBI:193107) |
| Incoming Relation(s) |
| N6,N6-dimethyl-L-lysinium (CHEBI:193107) is conjugate acid of N6,N6-dimethyl-L-lysine (CHEBI:43997) |
| N6,N6-dimethyl-L-lysine residue (CHEBI:61969) is substituent group from N6,N6-dimethyl-L-lysine (CHEBI:43997) |
| IUPAC Name |
|---|
| N6,N6-dimethyl-L-lysine |
| Synonyms | Source |
|---|---|
| Nε,Nε-dimethyllysine | ChEBI |
| Lys(Me2) | ChEBI |
| Nε-dimethyl-L-lysine | ChEBI |
| Nε,Nε-dimethyl-L-lysine | ChEBI |
| Nε-dimethyllysine | ChEBI |
| N6,N6-dimethyllysine | ChEBI |
| Citations |
|---|