EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H19N2O2 |
| Net Charge | +1 |
| Average Mass | 175.252 |
| Monoisotopic Mass | 175.14410 |
| SMILES | C[NH+](C)CCCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C8H18N2O2/c1-10(2)6-4-3-5-7(9)8(11)12/h7H,3-6,9H2,1-2H3,(H,11,12)/p+1/t7-/m0/s1 |
| InChIKey | XXEWFEBMSGLYBY-ZETCQYMHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6,N6-dimethyl-L-lysinium (CHEBI:193107) is a polar amino acid zwitterion (CHEBI:62031) |
| N6,N6-dimethyl-L-lysinium (CHEBI:193107) is conjugate acid of N6,N6-dimethyl-L-lysine (CHEBI:43997) |
| Incoming Relation(s) |
| N6,N6-dimethyl-L-lysine (CHEBI:43997) is conjugate base of N6,N6-dimethyl-L-lysinium (CHEBI:193107) |
| UniProt Name | Source |
|---|---|
| N6,N6-dimethyl-L-lysine | UniProt |
| Citations |
|---|