EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO7 |
| Net Charge | 0 |
| Average Mass | 293.316 |
| Monoisotopic Mass | 293.14745 |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](NC(=O)[C@@H](O)CCO)[C@H](O)[C@@H]1OC |
| InChI | InChI=1S/C12H23NO7/c1-6-8(13-11(17)7(15)4-5-14)9(16)10(18-2)12(19-3)20-6/h6-10,12,14-16H,4-5H2,1-3H3,(H,13,17)/t6-,7+,8-,9+,10+,12+/m1/s1 |
| InChIKey | NGGZJRAGGXAXNO-RPBIHCLYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 4,6-dideoxy-4-(3-deoxy-L-glycero-tetronamido)-2-O-methyl-α-D-mannopyranoside (CHEBI:43892) has functional parent α-D-mannose (CHEBI:28729) |
| methyl 4,6-dideoxy-4-(3-deoxy-L-glycero-tetronamido)-2-O-methyl-α-D-mannopyranoside (CHEBI:43892) has role epitope (CHEBI:53000) |
| methyl 4,6-dideoxy-4-(3-deoxy-L-glycero-tetronamido)-2-O-methyl-α-D-mannopyranoside (CHEBI:43892) is a N-acyl-hexosamine (CHEBI:21656) |
| methyl 4,6-dideoxy-4-(3-deoxy-L-glycero-tetronamido)-2-O-methyl-α-D-mannopyranoside (CHEBI:43892) is a methyl mannoside (CHEBI:25254) |
| IUPAC Name |
|---|
| methyl 4,6-dideoxy-4-[(2S)-2,4-dihydroxybutanamido]-2-O-methyl-α-D-mannopyranoside |
| Synonyms | Source |
|---|---|
| 1,2-di-O-methyl-4-[(2S)-2,4-dihydroxybutyramido]-4-deoxy-α-D-rhamnopyranoside | ChEBI |
| 1,2-O-DIMETHYL-4-[2,4-DIHYDROXY-BUTYRAMIDO]-4,6-DIDEOXY-ALPHA-D-MANNOPYRANOSIDE | PDBeChem |
| methyl 4,6-dideoxy-4-{[(2S)-2,4-dihydroxybutanoyl]amino}-2-O-methyl-α-D-mannopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MGS | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7414126 | Reaxys |
| Citations |
|---|