EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19Br2NO3 |
| Net Charge | 0 |
| Average Mass | 505.206 |
| Monoisotopic Mass | 502.97317 |
| SMILES | CC1(C)[C@H](C(=O)O[C@H](C#N)c2cccc(Oc3ccccc3)c2)[C@@H]1C=C(Br)Br |
| InChI | InChI=1S/C22H19Br2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18+,20-/m0/s1 |
| InChIKey | OWZREIFADZCYQD-NSHGMRRFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | calcium channel agonist Agents that increase calcium influx into calcium channels of excitable tissues. EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). |
| Applications: | antifeedant A substance that prevents pests from feeding. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deltamethrin (CHEBI:4388) has functional parent cis-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39344) |
| deltamethrin (CHEBI:4388) has role agrochemical (CHEBI:33286) |
| deltamethrin (CHEBI:4388) has role antifeedant (CHEBI:22583) |
| deltamethrin (CHEBI:4388) has role calcium channel agonist (CHEBI:38807) |
| deltamethrin (CHEBI:4388) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| deltamethrin (CHEBI:4388) has role pyrethroid ester insecticide (CHEBI:39116) |
| deltamethrin (CHEBI:4388) is a aromatic ether (CHEBI:35618) |
| deltamethrin (CHEBI:4388) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| deltamethrin (CHEBI:4388) is a nitrile (CHEBI:18379) |
| deltamethrin (CHEBI:4388) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (S)-cyano(3-phenoxyphenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarboxylate |
| Synonyms | Source |
|---|---|
| decamethrin | KEGG COMPOUND |
| decamethrine | DrugCentral |
| Deltamethrin | KEGG COMPOUND |
| (S)-cyano(3-phenoxyphenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate | Alan Wood's Pesticides |
| (S)-α-cyano-3-phenoxybenzyl (1R,3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate | Alan Wood's Pesticides |
| (S)-α-cyano-3-phenoxybenzyl (1R)-cis-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Ballistic | ChEBI |
| Cropro D-Sect | ChEBI |
| Decis | ChemIDplus |
| Decis Options | ChEBI |
| DeltaGard | ChEBI |
| Deltashield | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 205 | VSDB |
| 205 | PPDB |
| 4378 | DrugCentral |
| C10985 | KEGG COMPOUND |
| D07785 | KEGG DRUG |
| DB13600 | DrugBank |
| deltamethrin | Alan Wood's Pesticides |
| Deltamethrin | Wikipedia |
| HMDB0041866 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6746312 | Reaxys |
| CAS:52918-63-5 | NIST Chemistry WebBook |
| CAS:52918-63-5 | ChemIDplus |
| Citations |
|---|