EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2 |
| Net Charge | 0 |
| Average Mass | 101.105 |
| Monoisotopic Mass | 101.04768 |
| SMILES | C=C[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2-3H,1,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | RQVLGLPAZTUBKX-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 4.4.1.14 (1-aminocyclopropane-1-carboxylate synthase) inhibitor An EC 4.4.1.* (C‒S lyase) inhibitor that interferes with the action of 1-aminocyclopropane-1-carboxylate synthase (EC 4.4.1.14). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-vinylglycine (CHEBI:43858) has role EC 4.4.1.14 (1-aminocyclopropane-1-carboxylate synthase) inhibitor (CHEBI:136984) |
| L-vinylglycine (CHEBI:43858) is a glycine derivative (CHEBI:24373) |
| L-vinylglycine (CHEBI:43858) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-vinylglycine (CHEBI:43858) is tautomer of L-vinylglycine zwitterion (CHEBI:134467) |
| Incoming Relation(s) |
| L-vinylglycine zwitterion (CHEBI:134467) is tautomer of L-vinylglycine (CHEBI:43858) |
| IUPAC Name |
|---|
| (2S)-2-aminobut-3-enoic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-butenoic acid | ChEBI |
| Vinylglycine | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB03214 | DrugBank |
| EP0529601 | Patent |
| JP2007295865 | Patent |
| LVG | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1851376 | Reaxys |
| CAS:70982-53-5 | ChemIDplus |
| Citations |
|---|