EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2 |
| Net Charge | 0 |
| Average Mass | 101.105 |
| Monoisotopic Mass | 101.04768 |
| SMILES | C=C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2-3H,1,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | RQVLGLPAZTUBKX-VKHMYHEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-vinylglycine zwitterion (CHEBI:134467) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-vinylglycine zwitterion (CHEBI:134467) is tautomer of L-vinylglycine (CHEBI:43858) |
| Incoming Relation(s) |
| L-vinylglycine (CHEBI:43858) is tautomer of L-vinylglycine zwitterion (CHEBI:134467) |
| IUPAC Name |
|---|
| (2S)-2-azaniumylbut-3-enoate |
| Synonym | Source |
|---|---|
| (2S)-2-amino-3-butenoic acid zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (2S)-2-amino-3-butenoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13343 | MetaCyc |
| Citations |
|---|