EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N6O3S.CH4O3S |
| Net Charge | 0 |
| Average Mass | 552.679 |
| Monoisotopic Mass | 552.18247 |
| SMILES | CC(C)Nc1cccnc1N1CCN(C(=O)c2cc3cc(NS(C)(=O)=O)ccc3n2)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C22H28N6O3S.CH4O3S/c1-15(2)24-19-5-4-8-23-21(19)27-9-11-28(12-10-27)22(29)20-14-16-13-17(26-32(3,30)31)6-7-18(16)25-20;1-5(2,3)4/h4-8,13-15,24-26H,9-12H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | MEPNHSOMXMALDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delavirdine mesylate (CHEBI:4379) has part delavirdine (CHEBI:119573) |
| delavirdine mesylate (CHEBI:4379) has role antiviral drug (CHEBI:36044) |
| delavirdine mesylate (CHEBI:4379) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| delavirdine mesylate (CHEBI:4379) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| N-[2-({4-[3-(propan-2-ylamino)pyridin-2-yl]piperazin-1-yl}carbonyl)-1H-indol-5-yl]methanesulfonamide methanesulfonate |
| INN | Source |
|---|---|
| delavirdine mesilate | ChEBI |
| Synonyms | Source |
|---|---|
| 1-(3-(isopropylamino)-2-pyridyl)-4-((5-methanesulfonamidoindol-2-yl)carbonyl)piperazine monomethanesulfonate | ChemIDplus |
| Delavirdine mesilate | KEGG COMPOUND |
| Delavirdine mesylate | KEGG COMPOUND |
| DELAVIRDINE MESYLATE | ChEMBL |
| delavirdine methanesulfonate | ChEBI |
| delavirdine monomethanesulfonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7617470 | Beilstein |
| CAS:147221-93-0 | KEGG COMPOUND |
| CAS:147221-93-0 | ChemIDplus |