EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N6O3S |
| Net Charge | 0 |
| Average Mass | 456.572 |
| Monoisotopic Mass | 456.19436 |
| SMILES | CC(C)Nc1cccnc1N1CCN(C(=O)c2cc3cc(NS(C)(=O)=O)ccc3n2)CC1 |
| InChI | InChI=1S/C22H28N6O3S/c1-15(2)24-19-5-4-8-23-21(19)27-9-11-28(12-10-27)22(29)20-14-16-13-17(26-32(3,30)31)6-7-18(16)25-20/h4-8,13-15,24-26H,9-12H2,1-3H3 |
| InChIKey | WHBIGIKBNXZKFE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delavirdine (CHEBI:119573) has role anti-HIV agent (CHEBI:64946) |
| delavirdine (CHEBI:119573) has role antiviral agent (CHEBI:22587) |
| delavirdine (CHEBI:119573) has role antiviral drug (CHEBI:36044) |
| delavirdine (CHEBI:119573) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| delavirdine (CHEBI:119573) is a N-acylpiperazine (CHEBI:46844) |
| delavirdine (CHEBI:119573) is a aminopyridine (CHEBI:38207) |
| delavirdine (CHEBI:119573) is a indolecarboxamide (CHEBI:46921) |
| delavirdine (CHEBI:119573) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| delavirdine mesylate (CHEBI:4379) has part delavirdine (CHEBI:119573) |
| IUPAC Name |
|---|
| N-[2-({4-[3-(propan-2-ylamino)pyridin-2-yl]piperazin-1-yl}carbonyl)-1H-indol-5-yl]methanesulfonamide |
| INNs | Source |
|---|---|
| delavirdina | WHO MedNet |
| delavirdine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(3-((1-methylethyl)amino)-2-pyridinyl)-4-((5-((methylsulfonyl)amino)-1H-indol-2-yl)carbonyl)piperazine | ChemIDplus |
| 2-(4-(5-methanesulfonamido-1H-indol-2-ylcarbonyl)-1-piperazinyl)-N-(1-methylethyl)-3-pyridinamine | ChemIDplus |
| Delavirdine | KEGG COMPOUND |
| N-(2-(1-(3-(isopropylamino)pyridin-2-yl)piperazine-4-carbonyl)-1H-indol-5-yl)methanesulfonamide | ChEMBL |
| (N-[2-[4-[3-(1-methylethylamino)pyridin-2-yl]piperazin-1-yl]carbonyl-1H-indol-5-yl] methanesulfonamide) | ChEMBL |
| N-{2-[4-(3-Isopropylamino-pyridin-2-yl)-piperazine-1-carbonyl]-1H-indol-5-yl}-methanesulfonamide | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6356813 | Reaxys |
| CAS:136817-59-9 | ChemIDplus |
| CAS:136817-59-9 | KEGG COMPOUND |
| Citations |
|---|