EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)C1=C(O)[C@H](O)[C@@H](O)C(O)O1 |
| WURCS | WURCS=2.0/1,1,0/[a21EEA-1x_1-5]/1/ |
| InChI | InChI=1S/C6H8O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1,3,6-9,12H,(H,10,11)/t1-,3+,6?/m0/s1 |
| InChIKey | BPCLKHIDDIVGBM-HQBUBJCFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dehydro-D-glucuronic acid (CHEBI:43262) is a glucuronic acids (CHEBI:33886) |
| 4,5-dehydro-D-glucuronic acid (CHEBI:43262) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| L-threo-hex-4-enopyranuronosyl-(1→4)-D-GlcpNS (CHEBI:149650) has functional parent 4,5-dehydro-D-glucuronic acid (CHEBI:43262) |
| Δ4-β-D-GlcpA-(1→4)-α-D-GlcpNAc (CHEBI:150237) has functional parent 4,5-dehydro-D-glucuronic acid (CHEBI:43262) |
| Δ4-β-D-GlcpA-(1→3)-β-D-GalpNAc4S (CHEBI:146580) has functional parent 4,5-dehydro-D-glucuronic acid (CHEBI:43262) |
| IUPAC Name |
|---|
| α-L-threo-hex-4-enopyranuronic acid |