EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4315 - danazol
| Formula | C22H27NO2 |
| Net Charge | 0 |
| Average Mass | 337.463 |
| Monoisotopic Mass | 337.20418 |
| SMILES | [H][C@@]12CCC3=Cc4oncc4C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@@]1(O)C#C |
| InChI | InChI=1S/C22H27NO2/c1-4-22(24)10-8-18-16-6-5-15-11-19-14(13-23-25-19)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,13,16-18,24H,5-10,12H2,2-3H3/t16-,17+,18+,20+,21+,22+/m1/s1 |
| InChIKey | POZRVZJJTULAOH-LHZXLZLDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danazol (CHEBI:4315) has parent hydride pregnane (CHEBI:8386) |
| danazol (CHEBI:4315) has role anti-estrogen (CHEBI:50751) |
| danazol (CHEBI:4315) has role estrogen antagonist (CHEBI:50837) |
| danazol (CHEBI:4315) has role geroprotector (CHEBI:176497) |
| danazol (CHEBI:4315) is a 17β-hydroxy steroid (CHEBI:35343) |
| danazol (CHEBI:4315) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| [1,2]oxazolo[4',5':2,3]-17α-pregn-4-en-20-yn-17-ol |
| INNs | Source |
|---|---|
| danazol | KEGG DRUG |
| danazolum | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cyclomen | DrugBank |
| Danocrine | DrugBank |
| Citations |
|---|