EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO2 |
| Net Charge | 0 |
| Average Mass | 337.463 |
| Monoisotopic Mass | 337.20418 |
| SMILES | [H][C@@]12CCC3=Cc4oncc4C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@@]1(O)C#C |
| InChI | InChI=1S/C22H27NO2/c1-4-22(24)10-8-18-16-6-5-15-11-19-14(13-23-25-19)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,13,16-18,24H,5-10,12H2,2-3H3/t16-,17+,18+,20+,21+,22+/m1/s1 |
| InChIKey | POZRVZJJTULAOH-LHZXLZLDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| Applications: | estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danazol (CHEBI:4315) has parent hydride pregnane (CHEBI:8386) |
| danazol (CHEBI:4315) has role anti-estrogen (CHEBI:50751) |
| danazol (CHEBI:4315) has role estrogen antagonist (CHEBI:50837) |
| danazol (CHEBI:4315) has role geroprotector (CHEBI:176497) |
| danazol (CHEBI:4315) is a 17β-hydroxy steroid (CHEBI:35343) |
| danazol (CHEBI:4315) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| [1,2]oxazolo[4',5':2,3]-17α-pregn-4-en-20-yn-17-ol |
| INNs | Source |
|---|---|
| danazol | KEGG DRUG |
| danazolum | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cyclomen | DrugBank |
| Danocrine | DrugBank |
| Citations |
|---|