EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4315 - danazol
| Formula | C22H27NO2 |
| Net Charge | 0 |
| Average Mass | 337.463 |
| Monoisotopic Mass | 337.20418 |
| SMILES | [H][C@@]12CCC3=Cc4oncc4C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@@]1(O)C#C |
| InChI | InChI=1S/C22H27NO2/c1-4-22(24)10-8-18-16-6-5-15-11-19-14(13-23-25-19)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,13,16-18,24H,5-10,12H2,2-3H3/t16-,17+,18+,20+,21+,22+/m1/s1 |
| InChIKey | POZRVZJJTULAOH-LHZXLZLDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danazol (CHEBI:4315) has parent hydride pregnane (CHEBI:8386) |
| danazol (CHEBI:4315) has role anti-anaemic agent (CHEBI:75835) |
| danazol (CHEBI:4315) has role anti-estrogen (CHEBI:50751) |
| danazol (CHEBI:4315) has role antineoplastic agent (CHEBI:35610) |
| danazol (CHEBI:4315) has role estrogen antagonist (CHEBI:50837) |
| danazol (CHEBI:4315) has role geroprotector (CHEBI:176497) |
| danazol (CHEBI:4315) is a 17β-hydroxy steroid (CHEBI:35343) |
| danazol (CHEBI:4315) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| [1,2]oxazolo[4',5':2,3]-17α-pregn-4-en-20-yn-17-ol |
| INNs | Source |
|---|---|
| danazol | KEGG DRUG |
| danazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| NSC-270916 | ChEMBL |
| WIN 17,757 | ChEMBL |
| WIN-17757 | ChEMBL |
| Brand Names | Source |
|---|---|
| Cyclomen | DrugBank |
| Danocrine | DrugBank |
| Citations |
|---|