EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O14P3 |
| Net Charge | 0 |
| Average Mass | 523.181 |
| Monoisotopic Mass | 522.99066 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | XKMLYUALXHKNFT-UUOKFMHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). uncoupling protein inhibitor Any inhibitor that acts on uncoupling protein. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GTP (CHEBI:15996) has role Escherichia coli metabolite (CHEBI:76971) |
| GTP (CHEBI:15996) has role mouse metabolite (CHEBI:75771) |
| GTP (CHEBI:15996) has role uncoupling protein inhibitor (CHEBI:145437) |
| GTP (CHEBI:15996) is a guanosine 5'-phosphate (CHEBI:37121) |
| GTP (CHEBI:15996) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| GTP (CHEBI:15996) is conjugate acid of GTP(3−) (CHEBI:57600) |
| Incoming Relation(s) |
| N2,N2,N7-trimethylguanosine 5'-triphosphate(1+) (CHEBI:74659) has functional parent GTP (CHEBI:15996) |
| 7-methyl-GTP (CHEBI:50210) has functional parent GTP (CHEBI:15996) |
| ddhGTP (CHEBI:156335) has functional parent GTP (CHEBI:15996) |
| ethyl-GTP (CHEBI:62908) has functional parent GTP (CHEBI:15996) |
| guanosine 5'-[γ-thio]triphosphate (CHEBI:43000) has functional parent GTP (CHEBI:15996) |
| γ-aminooctyl-GTP (CHEBI:85167) is a GTP (CHEBI:15996) |
| GTP(3−) (CHEBI:57600) is conjugate base of GTP (CHEBI:15996) |
| IUPAC Name |
|---|
| guanosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 5'-GTP | ChemIDplus |
| GTP | KEGG COMPOUND |
| Guanosine 5'-triphosphate | KEGG COMPOUND |
| GUANOSINE-5'-TRIPHOSPHATE | PDBeChem |
| guanosine 5'-triphosphoric acid | ChemIDplus |
| guanosine triphosphate | ChemIDplus |
| Citations |
|---|