EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO2 |
| Net Charge | 0 |
| Average Mass | 139.154 |
| Monoisotopic Mass | 139.06333 |
| SMILES | N[C@H]1C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C7H9NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-3,6H,4,8H2,(H,9,10)/t6-/m0/s1 |
| InChIKey | KFNRJXCQEJIBER-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-gabaculine (CHEBI:42790) is a 5-aminocyclohexa-1,3-diene-1-carboxylic acid (CHEBI:29585) |
| (R)-gabaculine (CHEBI:42790) is enantiomer of (S)-gabaculine (CHEBI:145084) |
| Incoming Relation(s) |
| rac-gabaculine (CHEBI:145090) has part (R)-gabaculine (CHEBI:42790) |
| (S)-gabaculine (CHEBI:145084) is enantiomer of (R)-gabaculine (CHEBI:42790) |
| IUPAC Name |
|---|
| (5R)-5-aminocyclohexa-1,3-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| (R)-5-aminocyclohexa-1,3-diene-1-carboxylic acid | ChEBI |
| (R)-5-amino-1,3-cyclohexadiene-1-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| GBC | PDBeChem |