EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO2 |
| Net Charge | 0 |
| Average Mass | 139.154 |
| Monoisotopic Mass | 139.06333 |
| SMILES | N[C@@H]1C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C7H9NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-3,6H,4,8H2,(H,9,10)/t6-/m1/s1 |
| InChIKey | KFNRJXCQEJIBER-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces toyocaensis (ncbitaxon:55952) | cell suspension culture (BTO:0000221) | DOI (10.1016/S0040-4039(00)77904-4) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.6.1.19 (4-aminobutyrate--2-oxoglutarate transaminase) inhibitor An EC 2.6.1.* (transaminase) inhibitor that interferes with the action of 4-aminobutyrate—2-oxoglutarate transaminase (EC 2.6.1.19). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-gabaculine (CHEBI:145084) has role bacterial metabolite (CHEBI:76969) |
| (S)-gabaculine (CHEBI:145084) has role EC 2.6.1.19 (4-aminobutyrate—2-oxoglutarate transaminase) inhibitor (CHEBI:63674) |
| (S)-gabaculine (CHEBI:145084) is a 5-aminocyclohexa-1,3-diene-1-carboxylic acid (CHEBI:29585) |
| (S)-gabaculine (CHEBI:145084) is enantiomer of (R)-gabaculine (CHEBI:42790) |
| Incoming Relation(s) |
| rac-gabaculine (CHEBI:145090) has part (S)-gabaculine (CHEBI:145084) |
| (R)-gabaculine (CHEBI:42790) is enantiomer of (S)-gabaculine (CHEBI:145084) |
| IUPAC Name |
|---|
| (5S)-5-aminocyclohexa-1,3-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| (−)-5-amino-1,3-cyclohexadiene-1-carboxylic acid | ChemIDplus |
| gabaculin | ChemIDplus |
| (−)-gabaculine | ChEBI |
| gabaculine | ChEBI |
| (S)-5-amino-1,3-cyclohexadiene-1-carboxylic acid | ChEBI |
| [S,(−)]-5-amino-1,3-cyclohexadiene-1-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00000740 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4662689 | Beilstein |
| CAS:59556-29-5 | ChemIDplus |
| Citations |
|---|