EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:42471 - forskolin
| Formula | C22H34O7 |
| Net Charge | 0 |
| Average Mass | 410.507 |
| Monoisotopic Mass | 410.23045 |
| SMILES | [H][C@@]12[C@H](O)[C@H](OC(C)=O)[C@@]3(C)O[C@@](C)(C=C)CC(=O)[C@]3(O)[C@@]1(C)[C@@H](O)CCC2(C)C |
| InChI | InChI=1S/C22H34O7/c1-8-19(5)11-14(25)22(27)20(6)13(24)9-10-18(3,4)16(20)15(26)17(28-12(2)23)21(22,7)29-19/h8,13,15-17,24,26-27H,1,9-11H2,2-7H3/t13-,15-,16-,17-,19-,20-,21+,22-/m0/s1 |
| InChIKey | OHCQJHSOBUTRHG-KGGHGJDLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | protein kinase A agonist A protein kinase agonist that selectively binds to and activates a protein kinase A receptor anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. adenylate cyclase agonist Any agonist of one or more of the isoforms of adenylate cyclase (EC 4.6.1.1). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| forskolin (CHEBI:42471) has role adenylate cyclase agonist (CHEBI:78548) |
| forskolin (CHEBI:42471) has role anti-HIV agent (CHEBI:64946) |
| forskolin (CHEBI:42471) has role antihypertensive agent (CHEBI:35674) |
| forskolin (CHEBI:42471) has role plant metabolite (CHEBI:76924) |
| forskolin (CHEBI:42471) has role platelet aggregation inhibitor (CHEBI:50427) |
| forskolin (CHEBI:42471) has role protein kinase A agonist (CHEBI:78547) |
| forskolin (CHEBI:42471) is a acetate ester (CHEBI:47622) |
| forskolin (CHEBI:42471) is a cyclic ketone (CHEBI:3992) |
| forskolin (CHEBI:42471) is a labdane diterpenoid (CHEBI:36770) |
| forskolin (CHEBI:42471) is a organic heterotricyclic compound (CHEBI:26979) |
| forskolin (CHEBI:42471) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| forskolin (CHEBI:42471) is a triol (CHEBI:27136) |
| Incoming Relation(s) |
| 1,9-dideoxyforskolin (CHEBI:50295) has functional parent forskolin (CHEBI:42471) |
| colforsin daropate (CHEBI:166826) has functional parent forskolin (CHEBI:42471) |
| methylpiperazinoforskolin (CHEBI:42430) has functional parent forskolin (CHEBI:42471) |
| IUPAC Name |
|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-benzo[f]chromen-5-yl acetate |
| INNs | Source |
|---|---|
| colforsin | ChemIDplus |
| colforsina | ChemIDplus |
| colforsine | ChemIDplus |
| colforsinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 7β-acetoxy-8,13-epoxy-1α,6β,9α-trihydroxylabd-14-en-11-one | ChemIDplus |
| Coleonol | KEGG COMPOUND |
| Coleonolk | KEGG COMPOUND |
| Colforsin | KEGG COMPOUND |
| Forskolin | KEGG COMPOUND |
| FORSKOLIN | PDBeChem |
| Citations |
|---|