EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O7 |
| Net Charge | 0 |
| Average Mass | 410.507 |
| Monoisotopic Mass | 410.23045 |
| SMILES | [H][C@@]12[C@H](O)[C@H](OC(C)=O)[C@@]3(C)O[C@@](C)(C=C)CC(=O)[C@]3(O)[C@@]1(C)[C@@H](O)CCC2(C)C |
| InChI | InChI=1S/C22H34O7/c1-8-19(5)11-14(25)22(27)20(6)13(24)9-10-18(3,4)16(20)15(26)17(28-12(2)23)21(22,7)29-19/h8,13,15-17,24,26-27H,1,9-11H2,2-7H3/t13-,15-,16-,17-,19-,20-,21+,22-/m0/s1 |
| InChIKey | OHCQJHSOBUTRHG-KGGHGJDLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | adenylate cyclase agonist Any agonist of one or more of the isoforms of adenylate cyclase (EC 4.6.1.1). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. protein kinase A agonist A protein kinase agonist that selectively binds to and activates a protein kinase A receptor |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| forskolin (CHEBI:42471) has role adenylate cyclase agonist (CHEBI:78548) |
| forskolin (CHEBI:42471) has role anti-HIV agent (CHEBI:64946) |
| forskolin (CHEBI:42471) has role antihypertensive agent (CHEBI:35674) |
| forskolin (CHEBI:42471) has role plant metabolite (CHEBI:76924) |
| forskolin (CHEBI:42471) has role platelet aggregation inhibitor (CHEBI:50427) |
| forskolin (CHEBI:42471) has role protein kinase A agonist (CHEBI:78547) |
| forskolin (CHEBI:42471) is a acetate ester (CHEBI:47622) |
| forskolin (CHEBI:42471) is a cyclic ketone (CHEBI:3992) |
| forskolin (CHEBI:42471) is a labdane diterpenoid (CHEBI:36770) |
| forskolin (CHEBI:42471) is a organic heterotricyclic compound (CHEBI:26979) |
| forskolin (CHEBI:42471) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| forskolin (CHEBI:42471) is a triol (CHEBI:27136) |
| Incoming Relation(s) |
| 1,9-dideoxyforskolin (CHEBI:50295) has functional parent forskolin (CHEBI:42471) |
| colforsin daropate (CHEBI:166826) has functional parent forskolin (CHEBI:42471) |
| methylpiperazinoforskolin (CHEBI:42430) has functional parent forskolin (CHEBI:42471) |
| IUPAC Name |
|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-benzo[f]chromen-5-yl acetate |
| INNs | Source |
|---|---|
| colforsin | ChemIDplus |
| colforsina | ChemIDplus |
| colforsine | ChemIDplus |
| colforsinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 7β-acetoxy-8,13-epoxy-1α,6β,9α-trihydroxylabd-14-en-11-one | ChemIDplus |
| Coleonol | KEGG COMPOUND |
| Coleonolk | KEGG COMPOUND |
| Colforsin | KEGG COMPOUND |
| Forskolin | KEGG COMPOUND |
| FORSKOLIN | PDBeChem |
| Citations |
|---|