EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO8 |
| Net Charge | 0 |
| Average Mass | 509.640 |
| Monoisotopic Mass | 509.29887 |
| SMILES | [H][C@@]12[C@H](OC(=O)CCN(C)C)[C@H](OC(C)=O)[C@@]3(C)O[C@@](C)(C=C)CC(=O)[C@]3(O)[C@@]1(C)[C@@H](O)CCC2(C)C |
| InChI | InChI=1S/C27H43NO8/c1-10-24(5)15-18(31)27(33)25(6)17(30)11-13-23(3,4)21(25)20(35-19(32)12-14-28(8)9)22(34-16(2)29)26(27,7)36-24/h10,17,20-22,30,33H,1,11-15H2,2-9H3/t17-,20-,21-,22-,24-,25-,26+,27-/m0/s1 |
| InChIKey | RSOZZQTUMVBTMR-XGUNBQNXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | adenylate cyclase agonist Any agonist of one or more of the isoforms of adenylate cyclase (EC 4.6.1.1). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colforsin daropate (CHEBI:166826) has functional parent forskolin (CHEBI:42471) |
| colforsin daropate (CHEBI:166826) has role adenylate cyclase agonist (CHEBI:78548) |
| colforsin daropate (CHEBI:166826) has role antihypertensive agent (CHEBI:35674) |
| colforsin daropate (CHEBI:166826) has role cardiotonic drug (CHEBI:38147) |
| colforsin daropate (CHEBI:166826) has role vasodilator agent (CHEBI:35620) |
| colforsin daropate (CHEBI:166826) is a acetate ester (CHEBI:47622) |
| colforsin daropate (CHEBI:166826) is a carboxylic ester (CHEBI:33308) |
| colforsin daropate (CHEBI:166826) is a cyclic ketone (CHEBI:3992) |
| colforsin daropate (CHEBI:166826) is a diol (CHEBI:23824) |
| colforsin daropate (CHEBI:166826) is a organic heterotricyclic compound (CHEBI:26979) |
| colforsin daropate (CHEBI:166826) is a tertiary amino compound (CHEBI:50996) |
| colforsin daropate (CHEBI:166826) is conjugate base of colforsin daropate(1+) (CHEBI:166832) |
| Incoming Relation(s) |
| colforsin daropate(1+) (CHEBI:166832) is conjugate acid of colforsin daropate (CHEBI:166826) |
| IUPAC Name |
|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-benzo[f]chromen-6-yl N,N-dimethyl-β-alaninate |
| Synonyms | Source |
|---|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-naphtho[2,1-b]pyran-6-yl N,N-dimethyl-β-alaninate | IUPAC |
| 6-(3-dimethylaminopropionyl)forskolin | ChEBI |
| colforsin dapropate | ChEBI |
| N,N-dimethyl-β-alanine (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyldodecahydro-10-10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-1H-naphtho[2,1-b]pyran-6-yl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 729 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:113462-26-3 | ChemIDplus |
| Citations |
|---|