EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO8 |
| Net Charge | 0 |
| Average Mass | 509.640 |
| Monoisotopic Mass | 509.29887 |
| SMILES | [H][C@@]12[C@H](OC(=O)CCN(C)C)[C@H](OC(C)=O)[C@@]3(C)O[C@@](C)(C=C)CC(=O)[C@]3(O)[C@@]1(C)[C@@H](O)CCC2(C)C |
| InChI | InChI=1S/C27H43NO8/c1-10-24(5)15-18(31)27(33)25(6)17(30)11-13-23(3,4)21(25)20(35-19(32)12-14-28(8)9)22(34-16(2)29)26(27,7)36-24/h10,17,20-22,30,33H,1,11-15H2,2-9H3/t17-,20-,21-,22-,24-,25-,26+,27-/m0/s1 |
| InChIKey | RSOZZQTUMVBTMR-XGUNBQNXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | adenylate cyclase agonist Any agonist of one or more of the isoforms of adenylate cyclase (EC 4.6.1.1). |
| Applications: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colforsin daropate (CHEBI:166826) has functional parent forskolin (CHEBI:42471) |
| colforsin daropate (CHEBI:166826) has role adenylate cyclase agonist (CHEBI:78548) |
| colforsin daropate (CHEBI:166826) has role antihypertensive agent (CHEBI:35674) |
| colforsin daropate (CHEBI:166826) has role cardiotonic drug (CHEBI:38147) |
| colforsin daropate (CHEBI:166826) has role vasodilator agent (CHEBI:35620) |
| colforsin daropate (CHEBI:166826) is a acetate ester (CHEBI:47622) |
| colforsin daropate (CHEBI:166826) is a carboxylic ester (CHEBI:33308) |
| colforsin daropate (CHEBI:166826) is a cyclic ketone (CHEBI:3992) |
| colforsin daropate (CHEBI:166826) is a diol (CHEBI:23824) |
| colforsin daropate (CHEBI:166826) is a organic heterotricyclic compound (CHEBI:26979) |
| colforsin daropate (CHEBI:166826) is a tertiary amino compound (CHEBI:50996) |
| colforsin daropate (CHEBI:166826) is conjugate base of colforsin daropate(1+) (CHEBI:166832) |
| Incoming Relation(s) |
| colforsin daropate(1+) (CHEBI:166832) is conjugate acid of colforsin daropate (CHEBI:166826) |
| IUPAC Name |
|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-benzo[f]chromen-6-yl N,N-dimethyl-β-alaninate |
| Synonyms | Source |
|---|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-naphtho[2,1-b]pyran-6-yl N,N-dimethyl-β-alaninate | IUPAC |
| N,N-dimethyl-β-alanine (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyldodecahydro-10-10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-1H-naphtho[2,1-b]pyran-6-yl ester | ChEBI |
| colforsin dapropate | ChEBI |
| 6-(3-dimethylaminopropionyl)forskolin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 729 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:113462-26-3 | ChemIDplus |
| Citations |
|---|