EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5?/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-SOOFDHNKSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fundamental metabolite Any metabolite produced by all living cells. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-ribofuranose (CHEBI:47013) is a D-ribose (CHEBI:16988) |
| D-ribofuranose (CHEBI:47013) is a ribofuranose (CHEBI:46998) |
| Incoming Relation(s) |
| S-(5-deoxy-D-ribos-5-yl)-L-homocysteine (CHEBI:17575) has functional parent D-ribofuranose (CHEBI:47013) |
| D-ribofuranose 5-phosphate (CHEBI:52742) has functional parent D-ribofuranose (CHEBI:47013) |
| 2-deoxy-D-ribofuranose 1-phosphate (CHEBI:28542) has functional parent D-ribofuranose (CHEBI:47013) |
| purines D-ribonucleoside (CHEBI:142355) has functional parent D-ribofuranose (CHEBI:47013) |
| α-D-ribose (CHEBI:45506) is a D-ribofuranose (CHEBI:47013) |
| β-D-ribose (CHEBI:47002) is a D-ribofuranose (CHEBI:47013) |
| IUPAC Name |
|---|
| D-ribofuranose |
| Synonyms | Source |
|---|---|
| (3R,4S,5R)-5-(hydroxymethyl)tetrahydrofuran-2,3,4-triol | IUPAC |
| D-Ribose | KEGG COMPOUND |
| ribose | ChemIDplus |
| UniProt Name | Source |
|---|---|
| D-ribose | UniProt |
| Citations |
|---|