EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O3 |
| Net Charge | 0 |
| Average Mass | 214.265 |
| Monoisotopic Mass | 214.13174 |
| SMILES | C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)O |
| InChI | InChI=1S/C10H18N2O3/c1-7-8(12-10(15)11-7)5-3-2-4-6-9(13)14/h7-8H,2-6H2,1H3,(H,13,14)(H2,11,12,15)/t7-,8+/m0/s1 |
| InChIKey | AUTOLBMXDDTRRT-JGVFFNPUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R,5S)-dethiobiotin (CHEBI:42280) is a dethiobiotin (CHEBI:16691) |
| (4R,5S)-dethiobiotin (CHEBI:42280) is conjugate acid of (4R,5S)-dethiobiotin(1−) (CHEBI:149473) |
| (4R,5S)-dethiobiotin (CHEBI:42280) is enantiomer of (4S,5R)-dethiobiotin (CHEBI:37000) |
| Incoming Relation(s) |
| 9-mercaptodethiobiotin (CHEBI:133388) has functional parent (4R,5S)-dethiobiotin (CHEBI:42280) |
| (4R,5S)-dethiobiotin(1−) (CHEBI:149473) is conjugate base of (4R,5S)-dethiobiotin (CHEBI:42280) |
| (4S,5R)-dethiobiotin (CHEBI:37000) is enantiomer of (4R,5S)-dethiobiotin (CHEBI:42280) |
| IUPAC Name |
|---|
| 6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoic acid |
| Synonyms | Source |
|---|---|
| (4R,5S)-5-methyl-2-oxo-4-imidazolidinehexanoic acid | ChemIDplus |
| (4R-cis)-5-methyl-2-oxo-4-imidazolidinehexanoic acid | ChemIDplus |
| desthiobiotin | ChemIDplus |
| (+)-dethiobiotin | ChemIDplus |
| d-dethiobiotin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DTB | PDBeChem |
| HMDB0003581 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:84958 | Beilstein |
| CAS:533-48-2 | ChemIDplus |
| Citations |
|---|