EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O3S |
| Net Charge | 0 |
| Average Mass | 246.332 |
| Monoisotopic Mass | 246.10381 |
| SMILES | O=C(O)CCCCC[C@H]1NC(=O)N[C@H]1CS |
| InChI | InChI=1S/C10H18N2O3S/c13-9(14)5-3-1-2-4-7-8(6-16)12-10(15)11-7/h7-8,16H,1-6H2,(H,13,14)(H2,11,12,15)/t7-,8+/m1/s1 |
| InChIKey | ZARFDBYKHCOTRH-SFYZADRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | PubMed (25369450) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) | ||
| Escherichia coli (ncbitaxon:562) | - | PubMed (15610037) | Strain: TK101pI 3 BLS 2 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-mercaptodethiobiotin (CHEBI:133388) has functional parent (4R,5S)-dethiobiotin (CHEBI:42280) |
| 9-mercaptodethiobiotin (CHEBI:133388) has role Escherichia coli metabolite (CHEBI:76971) |
| 9-mercaptodethiobiotin (CHEBI:133388) is a imidazolidinone (CHEBI:55370) |
| 9-mercaptodethiobiotin (CHEBI:133388) is a monocarboxylic acid (CHEBI:25384) |
| 9-mercaptodethiobiotin (CHEBI:133388) is a thiol (CHEBI:29256) |
| 9-mercaptodethiobiotin (CHEBI:133388) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 6-[(4R,5R)-2-oxo-5-(sulfanylmethyl)imidazolidin-4-yl]hexanoic acid |
| Synonym | Source |
|---|---|
| 9-Mercaptodesthiobiotin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:139936-57-5 | ChemIDplus |
| Citations |
|---|