EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO222h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6+/m1/s1 |
| InChIKey | BJHIKXHVCXFQLS-PUFIMZNGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-psicose (CHEBI:27605) has role antilipemic drug (CHEBI:35679) |
| D-psicose (CHEBI:27605) has role antioxidant (CHEBI:22586) |
| D-psicose (CHEBI:27605) has role hypoglycemic agent (CHEBI:35526) |
| D-psicose (CHEBI:27605) has role plant metabolite (CHEBI:76924) |
| D-psicose (CHEBI:27605) is a psicose (CHEBI:33951) |
| D-psicose (CHEBI:27605) is enantiomer of L-psicose (CHEBI:145026) |
| Incoming Relation(s) |
| D-psicose 6-phosphate (CHEBI:61559) has functional parent D-psicose (CHEBI:27605) |
| D-psicose 6-phosphate(2−) (CHEBI:61519) has functional parent D-psicose (CHEBI:27605) |
| psicosamine (CHEBI:87176) has functional parent D-psicose (CHEBI:27605) |
| psicosamine 3-phosphate (CHEBI:87179) has functional parent D-psicose (CHEBI:27605) |
| psicosyllysine (CHEBI:61425) has functional parent D-psicose (CHEBI:27605) |
| L-psicose (CHEBI:145026) is enantiomer of D-psicose (CHEBI:27605) |
| IUPAC Names |
|---|
| D-ribo-hex-2-ulose |
| D-psicose |
| Synonyms | Source |
|---|---|
| D-Allulose | KEGG COMPOUND |
| D-Altrulose | KEGG COMPOUND |
| D-erythro-Hexulose | KEGG COMPOUND |
| D-Pseudofructose | KEGG COMPOUND |
| D-Psicose | KEGG COMPOUND |
| D-Psicose | ChemIDplus |
| UniProt Name | Source |
|---|---|
| D-allulose | UniProt |
| Citations |
|---|