EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24N2O7 |
| Net Charge | 0 |
| Average Mass | 308.331 |
| Monoisotopic Mass | 308.15835 |
| SMILES | N[C@@H](CCCCNCC(=O)[C@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C12H24N2O7/c13-7(12(20)21)3-1-2-4-14-5-8(16)10(18)11(19)9(17)6-15/h7,9-11,14-15,17-19H,1-6,13H2,(H,20,21)/t7-,9+,10-,11+/m0/s1 |
| InChIKey | BFSYFTQDGRDJNV-CDEVMZEPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psicosyllysine (CHEBI:61425) has functional parent D-psicose (CHEBI:27605) |
| psicosyllysine (CHEBI:61425) is a L-lysine derivative (CHEBI:25095) |
| psicosyllysine (CHEBI:61425) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| psicosyllysine (CHEBI:61425) is conjugate base of psicosyllysine(1+) (CHEBI:61403) |
| Incoming Relation(s) |
| psicosyllysine(1+) (CHEBI:61403) is conjugate acid of psicosyllysine (CHEBI:61425) |
| IUPAC Name |
|---|
| N6-[(3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]-L-lysine |
| Synonyms | Source |
|---|---|
| psicose-lysine | ChEBI |
| psicoselysine | ChEBI |