EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO111h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6+/m0/s1 |
| InChIKey | BJHIKXHVCXFQLS-ZXEDONINSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-psicose (CHEBI:145026) has role antiviral agent (CHEBI:22587) |
| L-psicose (CHEBI:145026) is a psicose (CHEBI:33951) |
| L-psicose (CHEBI:145026) is enantiomer of D-psicose (CHEBI:27605) |
| Incoming Relation(s) |
| D-psicose (CHEBI:27605) is enantiomer of L-psicose (CHEBI:145026) |
| IUPAC Name |
|---|
| L-psicose |
| Synonyms | Source |
|---|---|
| (3S,4S,5S)-1,3,4,5,6-pentahydroxyhexan-2-one | IUPAC |
| L-allulose | ChEBI |
| L-ribo-2-hexulose | ChemIDplus |
| UniProt Name | Source |
|---|---|
| L-allulose | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:16354-64-6 | ChemIDplus |
| Citations |
|---|