EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33BN6O5 |
| Net Charge | 0 |
| Average Mass | 460.344 |
| Monoisotopic Mass | 460.26055 |
| SMILES | CC(=O)N[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)B(O)O |
| InChI | InChI=1S/C21H33BN6O5/c1-14(29)26-16(13-15-7-3-2-4-8-15)20(31)28-12-6-9-17(28)19(30)27-18(22(32)33)10-5-11-25-21(23)24/h2-4,7-8,16-18,32-33H,5-6,9-13H2,1H3,(H,26,29)(H,27,30)(H4,23,24,25)/t16-,17+,18+/m1/s1 |
| InChIKey | FXFYPTZERULUBS-SQNIBIBYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) has role anticoagulant (CHEBI:50249) |
| Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) is a acetamides (CHEBI:22160) |
| Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) is a C-terminal boronic acid peptide (CHEBI:140517) |
| Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) is a guanidines (CHEBI:24436) |
| Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) is conjugate base of Ac-(D)Phe-Pro-boroArg-OH(1+) (CHEBI:140518) |
| Incoming Relation(s) |
| Ac-(D)Phe-Pro-boroArg-OH(1+) (CHEBI:140518) is conjugate acid of Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) |
| IUPAC Name |
|---|
| N-acetyl-D-phenylalanyl-N-[(1R)-1-borono-4-carbamimidamidobutyl]-L-prolinamide |
| Synonym | Source |
|---|---|
| acetylphenylalanyl-prolyl-boroarginine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DP7 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24287151 | Reaxys |
| CAS:130982-43-3 | ChemIDplus |