EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34BN6O5 |
| Net Charge | +1 |
| Average Mass | 461.352 |
| Monoisotopic Mass | 461.26783 |
| SMILES | CC(=O)N[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(N)=[NH2+])B(O)O |
| InChI | InChI=1S/C21H33BN6O5/c1-14(29)26-16(13-15-7-3-2-4-8-15)20(31)28-12-6-9-17(28)19(30)27-18(22(32)33)10-5-11-25-21(23)24/h2-4,7-8,16-18,32-33H,5-6,9-13H2,1H3,(H,26,29)(H,27,30)(H4,23,24,25)/p+1/t16-,17+,18+/m1/s1 |
| InChIKey | FXFYPTZERULUBS-SQNIBIBYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ac-(D)Phe-Pro-boroArg-OH(1+) (CHEBI:140518) is a guanidinium ion (CHEBI:60251) |
| Ac-(D)Phe-Pro-boroArg-OH(1+) (CHEBI:140518) is conjugate acid of Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) |
| Incoming Relation(s) |
| DuP-714 (CHEBI:140472) has part Ac-(D)Phe-Pro-boroArg-OH(1+) (CHEBI:140518) |
| Ac-(D)Phe-Pro-boroArg-OH (CHEBI:42142) is conjugate base of Ac-(D)Phe-Pro-boroArg-OH(1+) (CHEBI:140518) |