EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29NO10 |
| Net Charge | 0 |
| Average Mass | 527.526 |
| Monoisotopic Mass | 527.17915 |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H29NO10/c1-10-22(30)14(28)7-17(37-10)38-16-9-27(35,11(2)29)8-13-19(16)26(34)21-20(24(13)32)23(31)12-5-4-6-15(36-3)18(12)25(21)33/h4-6,10,14,16-17,22,30,32,34-35H,7-9,28H2,1-3H3/t10-,14-,16-,17-,22+,27-/m0/s1 |
| InChIKey | STQGQHZAVUOBTE-VGBVRHCVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura roseola (ncbitaxon:46179) | - | PubMed (10820108) | Strain: Ao108 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daunorubicin (CHEBI:41977) has parent hydride tetracene (CHEBI:32600) |
| daunorubicin (CHEBI:41977) has role antineoplastic agent (CHEBI:35610) |
| daunorubicin (CHEBI:41977) has role bacterial metabolite (CHEBI:76969) |
| daunorubicin (CHEBI:41977) is a p-quinones (CHEBI:25830) |
| daunorubicin (CHEBI:41977) is a aminoglycoside antibiotic (CHEBI:22507) |
| daunorubicin (CHEBI:41977) is a anthracycline (CHEBI:48120) |
| daunorubicin (CHEBI:41977) is a tetracenequinones (CHEBI:51286) |
| daunorubicin (CHEBI:41977) is conjugate base of daunorubicin(1+) (CHEBI:64677) |
| Incoming Relation(s) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) has functional parent daunorubicin (CHEBI:41977) |
| daunorubicin(1+) (CHEBI:64677) is conjugate acid of daunorubicin (CHEBI:41977) |
| IUPAC Name |
|---|
| (1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyranoside |
| INNs | Source |
|---|---|
| daunorubicin | ChemIDplus |
| daunorubicinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (8S-cis)-8-acetyl-10-((3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyrannosyl)oxy)-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-5,12-napthacenedione | ChemIDplus |
| acetyladriamycin | ChemIDplus |
| (+)-daunomycin | ChemIDplus |
| Daunomycin | KEGG COMPOUND |
| DAUNOMYCIN | PDBeChem |
| Daunorubicin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 786 | DrugCentral |
| C01907 | KEGG COMPOUND |
| D07776 | KEGG DRUG |
| Daunorubicin | Wikipedia |
| DB00694 | DrugBank |
| DM1 | PDBeChem |
| LMPK13050002 | LIPID MAPS |
| LSM-2962 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1445583 | Reaxys |
| CAS:20830-81-3 | KEGG COMPOUND |
| CAS:20830-81-3 | ChemIDplus |
| Citations |
|---|