EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO11 |
| Net Charge | 0 |
| Average Mass | 557.552 |
| Monoisotopic Mass | 557.18971 |
| SMILES | CC[C@@]1(O)C[C@H](O[C@H]2C[C@H](N)[C@H](O)[C@H](C)O2)c2c(O)c3c(c(O)c2[C@H]1C(=O)O)C(=O)c1cccc(OC)c1C3=O |
| InChI | InChI=1S/C28H31NO11/c1-4-28(37)9-14(40-15-8-12(29)22(30)10(2)39-15)17-18(21(28)27(35)36)26(34)19-20(25(17)33)24(32)16-11(23(19)31)6-5-7-13(16)38-3/h5-7,10,12,14-15,21-22,30,33-34,37H,4,8-9,29H2,1-3H3,(H,35,36)/t10-,12-,14-,15-,21-,22+,28+/m0/s1 |
| InChIKey | ROYGEIBVSIXOBH-QWWLYEKJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) has functional parent daunorubicin (CHEBI:41977) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) is a p-quinones (CHEBI:25830) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) is a aminoglycoside (CHEBI:47779) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) is a anthracycline antibiotic (CHEBI:49322) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) is a deoxy hexoside (CHEBI:35315) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) is a monosaccharide derivative (CHEBI:63367) |
| 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) is tautomer of 10-carboxy-13-deoxydaunorubicin zwitterion (CHEBI:77076) |
| Incoming Relation(s) |
| 10-carboxy-13-deoxydaunorubicin zwitterion (CHEBI:77076) is tautomer of 10-carboxy-13-deoxydaunorubicin (CHEBI:77195) |
| IUPAC Name |
|---|
| (1R,2R,4S)-4-[(3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyranosyl)oxy]-2-ethyl-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-15740 | MetaCyc |