EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H38N2 |
| Net Charge | +2 |
| Average Mass | 258.494 |
| Monoisotopic Mass | 258.30240 |
| SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C16H38N2/c1-17(2,3)15-13-11-9-7-8-10-12-14-16-18(4,5)6/h7-16H2,1-6H3/q+2 |
| InChIKey | MTCUAOILFDZKCO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decamethonium (CHEBI:41934) has parent hydride decane (CHEBI:41808) |
| decamethonium (CHEBI:41934) has role muscle relaxant (CHEBI:51371) |
| decamethonium (CHEBI:41934) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| decamethonium (CHEBI:41934) is a quaternary ammonium ion (CHEBI:35267) |
| IUPAC Name |
|---|
| N,N,N,N',N',N'-hexamethyldecane-1,10-diaminium |
| Synonyms | Source |
|---|---|
| Decamethonium | KEGG COMPOUND |
| Decamethonium cation | ChEMBL |
| DECAMETHONIUM ION | PDBeChem |
| decamethylenebis(trimethylammonium) | ChemIDplus |
| N,N,N,N',N',N'-hexamethyl-1,10-decanediaminium | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 789 | DrugCentral |
| C11733 | KEGG COMPOUND |
| DB01245 | DrugBank |
| Decamethonium | Wikipedia |
| DME | PDBeChem |
| HMDB0015375 | HMDB |
| LSM-6606 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1774794 | Reaxys |
| Beilstein:1774794 | Beilstein |
| CAS:156-74-1 | ChemIDplus |
| CAS:156-74-1 | KEGG COMPOUND |
| Citations |
|---|