EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:41921 - 1H-indene
| Formula | C9H8 |
| Net Charge | 0 |
| Average Mass | 116.163 |
| Monoisotopic Mass | 116.06260 |
| SMILES | C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C9H8/c1-2-5-9-7-3-6-8(9)4-1/h1-6H,7H2 |
| InChIKey | YBYIRNPNPLQARY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-indene (CHEBI:41921) is a ortho-fused bicyclic arene (CHEBI:35426) |
| 1H-indene (CHEBI:41921) is a indene (CHEBI:37910) |
| Incoming Relation(s) |
| (3S)-tetrahydrofuran-3-yl (1R,2S)-3-[4-((1R)-2-{[(S)-amino(hydroxy)methyl]oxy}-2,3-dihydro-1H-inden-1-yl)-2-benzyl-3-oxopyrrolidin-2-yl]-1-benzyl-2-hydroxypropylcarbamate (CHEBI:39981) has parent hydride 1H-indene (CHEBI:41921) |
| 1H-inden-1-yl (CHEBI:33053) has parent hydride 1H-indene (CHEBI:41921) |
| 1H-inden-1-ylidene (CHEBI:33052) has parent hydride 1H-indene (CHEBI:41921) |
| heptachlor (CHEBI:34785) has parent hydride 1H-indene (CHEBI:41921) |
| IUPAC Name |
|---|
| 1H-indene |
| Synonyms | Source |
|---|---|
| indene | NIST Chemistry WebBook |
| Inden | ChemIDplus |
| indonaphthene | ChemIDplus |
| INDENE | PDBeChem |
| Citations |
|---|