EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H5Cl7 |
| Net Charge | 0 |
| Average Mass | 373.321 |
| Monoisotopic Mass | 369.82109 |
| SMILES | ClC1=C(Cl)C2(Cl)C3C(Cl)C=CC3C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H5Cl7/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17/h1-5H |
| InChIKey | FRCCEHPWNOQAEU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptachlor (CHEBI:34785) has parent hydride 1H-indene (CHEBI:41921) |
| heptachlor (CHEBI:34785) has role agrochemical (CHEBI:33286) |
| heptachlor (CHEBI:34785) has role antibacterial agent (CHEBI:33282) |
| heptachlor (CHEBI:34785) has role antifungal agent (CHEBI:35718) |
| heptachlor (CHEBI:34785) has role GABA-gated chloride channel antagonist (CHEBI:38999) |
| heptachlor (CHEBI:34785) has role persistent organic pollutant (CHEBI:77853) |
| heptachlor (CHEBI:34785) is a cyclodiene organochlorine insecticide (CHEBI:23457) |
| IUPAC Name |
|---|
| 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-1H-4,7-methanoindene |
| Synonyms | Source |
|---|---|
| 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methano-1H-indene | ChemIDplus |
| 1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene | IUPAC |
| 3-chlorochlordene | ChemIDplus |
| Heptachlor | KEGG COMPOUND |
| Heptachlorane | KEGG COMPOUND |
| Heptamul | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 378 | PPDB |
| C14185 | KEGG COMPOUND |
| Heptachlor | Wikipedia |
| Citations |
|---|