EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O2 |
| Net Charge | 0 |
| Average Mass | 268.356 |
| Monoisotopic Mass | 268.14633 |
| SMILES | CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17+ |
| InChIKey | RGLYKWWBQGJZGM-ISLYRVAYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of 11β-hydroxysteroid dehydrogenase (EC 1.1.1.146). |
| Applications: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylstilbestrol (CHEBI:41922) has role antifungal agent (CHEBI:35718) |
| diethylstilbestrol (CHEBI:41922) has role antineoplastic agent (CHEBI:35610) |
| diethylstilbestrol (CHEBI:41922) has role autophagy inducer (CHEBI:138880) |
| diethylstilbestrol (CHEBI:41922) has role calcium channel blocker (CHEBI:38215) |
| diethylstilbestrol (CHEBI:41922) has role carcinogenic agent (CHEBI:50903) |
| diethylstilbestrol (CHEBI:41922) has role EC 1.1.1.146 (11β-hydroxysteroid dehydrogenase) inhibitor (CHEBI:137626) |
| diethylstilbestrol (CHEBI:41922) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| diethylstilbestrol (CHEBI:41922) has role endocrine disruptor (CHEBI:138015) |
| diethylstilbestrol (CHEBI:41922) has role xenoestrogen (CHEBI:76988) |
| diethylstilbestrol (CHEBI:41922) is a olefinic compound (CHEBI:78840) |
| diethylstilbestrol (CHEBI:41922) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| diethylstilbestrol diphosphate (CHEBI:4532) has functional parent diethylstilbestrol (CHEBI:41922) |
| IUPAC Name |
|---|
| 4,4'-(3E)-hex-3-ene-3,4-diyldiphenol |
| INNs | Source |
|---|---|
| diethylstilbestrol | ChemIDplus |
| diéthylstilbestrol | ChEBI |
| diethylstilbestrolum | ChemIDplus |
| dietilestilbestrol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4,4'-dihydroxy-α,β-diethylstilbene | NIST Chemistry WebBook |
| DES | KEGG COMPOUND |
| Diethylstilbestrol | KEGG COMPOUND |
| (E)-3,4-bis(4-hydroxyphenyl)-3-hexene | ChemIDplus |
| (E)-4,4'-(1,2-diethyl-1,2-ethenediyl)bisphenol | NIST Chemistry WebBook |
| trans-4,4'-(1,2-diethyl-1,2-ethenediyl)bisphenol | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Distilbene | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 875 | DrugCentral |
| C07620 | KEGG COMPOUND |
| D00577 | KEGG DRUG |
| DB00255 | DrugBank |
| DES | PDBeChem |
| Diethylstilbestrol | Wikipedia |
| FDB007498 | FooDB |
| HMDB0014400 | HMDB |
| Citations |
|---|