EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40N4 |
| Net Charge | +2 |
| Average Mass | 456.678 |
| Monoisotopic Mass | 456.32420 |
| SMILES | Cc1cc(N)c2ccccc2[n+]1CCCCCCCCCC[n+]1c(C)cc(N)c2ccccc21 |
| InChI | InChI=1S/C30H38N4/c1-23-21-27(31)25-15-9-11-17-29(25)33(23)19-13-7-5-3-4-6-8-14-20-34-24(2)22-28(32)26-16-10-12-18-30(26)34/h9-12,15-18,21-22,31-32H,3-8,13-14,19-20H2,1-2H3/p+2 |
| InChIKey | PCSWXVJAIHCTMO-UHFFFAOYSA-P |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dequalinium (CHEBI:41872) has role antifungal agent (CHEBI:35718) |
| dequalinium (CHEBI:41872) has role antineoplastic agent (CHEBI:35610) |
| dequalinium (CHEBI:41872) has role antiseptic drug (CHEBI:48218) |
| dequalinium (CHEBI:41872) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| dequalinium (CHEBI:41872) is a quinolinium ion (CHEBI:52837) |
| Incoming Relation(s) |
| dequalinium chloride (CHEBI:31466) has part dequalinium (CHEBI:41872) |
| Manual Xrefs | Databases |
|---|---|
| 4376 | DrugCentral |
| DEQ | PDBeChem |
| Dequalinium | Wikipedia |
| LSM-5846 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3741219 | Reaxys |
| CAS:6707-58-0 | ChemIDplus |