EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40N4.2Cl |
| Net Charge | 0 |
| Average Mass | 527.584 |
| Monoisotopic Mass | 526.26300 |
| SMILES | Cc1cc(N)c2ccccc2[n+]1CCCCCCCCCC[n+]1c(C)cc(N)c2ccccc21.[Cl-].[Cl-] |
| InChI | InChI=1S/C30H38N4.2ClH/c1-23-21-27(31)25-15-9-11-17-29(25)33(23)19-13-7-5-3-4-6-8-14-20-34-24(2)22-28(32)26-16-10-12-18-30(26)34;;/h9-12,15-18,21-22,31-32H,3-8,13-14,19-20H2,1-2H3;2*1H |
| InChIKey | LTNZEXKYNRNOGT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dequalinium chloride (CHEBI:31466) has part dequalinium (CHEBI:41872) |
| dequalinium chloride (CHEBI:31466) has role antibacterial agent (CHEBI:33282) |
| dequalinium chloride (CHEBI:31466) has role antifungal agent (CHEBI:35718) |
| dequalinium chloride (CHEBI:31466) has role antineoplastic agent (CHEBI:35610) |
| dequalinium chloride (CHEBI:31466) has role antiseptic drug (CHEBI:48218) |
| dequalinium chloride (CHEBI:31466) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| dequalinium chloride (CHEBI:31466) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 1,1'-decane-1,10-diylbis(4-amino-2-methylquinolinium) dichloride |
| INNs | Source |
|---|---|
| chlorure de dequalinium | ChemIDplus |
| cloruro de decalinio | ChemIDplus |
| cloruro de decualinio | WHO MedNet |
| dequalinii chloridum | ChemIDplus |
| dequalinium chloride | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1,1'-(1,10-Decanediyl)bis(4-amino-2-methylquinolinium) dichloride | ChemIDplus |
| 1,1'-Decamethylenebis(4-aminoquinaldinium chloride) | ChemIDplus |
| BAQD 10 | ChEMBL |
| BAQD-10 | ChEMBL |
| Decamethylenebis(4-aminoquinaldinium chloride) | ChemIDplus |
| Dekamin | ChEMBL |
| Brand Names | Source |
|---|---|
| Dequacets | ChEMBL |
| Dequadin | ChEMBL |
| Fluomizin | ChEMBL |
| Labosept | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01575 | KEGG DRUG |
| Dequalinium | Wikipedia |
| US2011015673 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5900124 | Reaxys |
| CAS:522-51-0 | KEGG DRUG |
| CAS:522-51-0 | ChemIDplus |
| Citations |
|---|