EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | N[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChIKey | WHUUTDBJXJRKMK-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glutamic acid (CHEBI:15966) has role Escherichia coli metabolite (CHEBI:76971) |
| D-glutamic acid (CHEBI:15966) has role mouse metabolite (CHEBI:75771) |
| D-glutamic acid (CHEBI:15966) is a D-α-amino acid (CHEBI:16733) |
| D-glutamic acid (CHEBI:15966) is a glutamic acid (CHEBI:18237) |
| D-glutamic acid (CHEBI:15966) is conjugate acid of D-glutamate(1−) (CHEBI:29986) |
| D-glutamic acid (CHEBI:15966) is enantiomer of L-glutamic acid (CHEBI:16015) |
| Incoming Relation(s) |
| D-glutamic acid derivative (CHEBI:83983) has functional parent D-glutamic acid (CHEBI:15966) |
| D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-Glu (CHEBI:75459) has functional parent D-glutamic acid (CHEBI:15966) |
| D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-Glu (CHEBI:75464) has functional parent D-glutamic acid (CHEBI:15966) |
| D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-γ-Glu-D-Glu (CHEBI:75484) has functional parent D-glutamic acid (CHEBI:15966) |
| L-Lys-D-Glu (CHEBI:144743) has functional parent D-glutamic acid (CHEBI:15966) |
| L-Orn-D-Glu (CHEBI:144747) has functional parent D-glutamic acid (CHEBI:15966) |
| D-glutamate(1−) (CHEBI:29986) is conjugate base of D-glutamic acid (CHEBI:15966) |
| L-glutamic acid (CHEBI:16015) is enantiomer of D-glutamic acid (CHEBI:15966) |
| D-glutamic acid residue (CHEBI:48096) is substituent group from D-glutamic acid (CHEBI:15966) |
| D-glutamo group (CHEBI:32482) is substituent group from D-glutamic acid (CHEBI:15966) |
| D-glutamoyl group (CHEBI:32481) is substituent group from D-glutamic acid (CHEBI:15966) |
| D-α-glutamyl group (CHEBI:32479) is substituent group from D-glutamic acid (CHEBI:15966) |
| D-γ-glutamyl group (CHEBI:32480) is substituent group from D-glutamic acid (CHEBI:15966) |
| IUPAC Names |
|---|
| (2R)-2-aminopentanedioic acid |
| D-glutamic acid |
| Synonyms | Source |
|---|---|
| D-2-Aminoglutaric acid | KEGG COMPOUND |
| DGL | PDBeChem |
| D-Glutamic acid | KEGG COMPOUND |
| D-Glutaminic acid | KEGG COMPOUND |
| glutamic acid D-form | ChemIDplus |
| (R)-2-aminopentanedioic acid | ChEBI |