EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O5 |
| Net Charge | 0 |
| Average Mass | 243.219 |
| Monoisotopic Mass | 243.08552 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | UHDGCWIWMRVCDJ-XVFCMESISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytidine (CHEBI:17562) has functional parent cytosine (CHEBI:16040) |
| cytidine (CHEBI:17562) has role Escherichia coli metabolite (CHEBI:76971) |
| cytidine (CHEBI:17562) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| cytidine (CHEBI:17562) has role antineoplastic agent (CHEBI:35610) |
| cytidine (CHEBI:17562) has role antipsychotic agent (CHEBI:35476) |
| cytidine (CHEBI:17562) has role human metabolite (CHEBI:77746) |
| cytidine (CHEBI:17562) has role mouse metabolite (CHEBI:75771) |
| cytidine (CHEBI:17562) has role ophthalmology drug (CHEBI:66981) |
| cytidine (CHEBI:17562) is a cytidines (CHEBI:23524) |
| Incoming Relation(s) |
| N4-hydroxycytidine (CHEBI:180654) has functional parent cytidine (CHEBI:17562) |
| 3'-deoxy-3',4'-didehydro-cytidine (CHEBI:156331) has functional parent cytidine (CHEBI:17562) |
| 5-ethynylcytidine (CHEBI:228294) has functional parent cytidine (CHEBI:17562) |
| 5-formylcytidine (CHEBI:234279) has functional parent cytidine (CHEBI:17562) |
| cytidine residue (CHEBI:64656) is substituent group from cytidine (CHEBI:17562) |
| IUPAC Name |
|---|
| cytidine |
| Synonyms | Source |
|---|---|
| 1-beta-D-Ribofuranosylcytosine | HMDB |
| 1β-D-ribofuranosylcytosine | NIST Chemistry WebBook |
| 4-AMINO-1-BETA-D-RIBOFURANOSYL-2(1H)-PYRIMIDINONE | PDBeChem |
| 4-amino-1β-D-ribofuranosyl-2(1H)-pyrimidinone | NIST Chemistry WebBook |
| 4-amino-1-β-D-ribofuranosylpyrimidin-2(1H)-one | ChEBI |
| Cyd | IUBMB |
| UniProt Name | Source |
|---|---|
| cytidine | UniProt |
| Citations |
|---|