EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O6 |
| Net Charge | 0 |
| Average Mass | 259.218 |
| Monoisotopic Mass | 259.08044 |
| SMILES | O=c1nc(=NO)ccn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H13N3O6/c13-3-4-6(14)7(15)8(18-4)12-2-1-5(11-17)10-9(12)16/h1-2,4,6-8,13-15,17H,3H2,(H,10,11,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | XCUAIINAJCDIPM-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| saliva (UBERON:0001836) | PubMed (34509661) | ||
| blood plasma (BTO:0000118) | PubMed (34509661) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N4-hydroxycytidine (CHEBI:180654) has functional parent cytidine (CHEBI:17562) |
| N4-hydroxycytidine (CHEBI:180654) has role anticoronaviral agent (CHEBI:149553) |
| N4-hydroxycytidine (CHEBI:180654) has role antiviral agent (CHEBI:22587) |
| N4-hydroxycytidine (CHEBI:180654) has role drug metabolite (CHEBI:49103) |
| N4-hydroxycytidine (CHEBI:180654) has role human xenobiotic metabolite (CHEBI:76967) |
| N4-hydroxycytidine (CHEBI:180654) is a ketoxime (CHEBI:24983) |
| N4-hydroxycytidine (CHEBI:180654) is a nucleoside analogue (CHEBI:60783) |
| Incoming Relation(s) |
| molnupiravir (CHEBI:180653) has functional parent N4-hydroxycytidine (CHEBI:180654) |
| IUPAC Name |
|---|
| N-hydroxy-3,4-dihydrocytidine |
| Synonyms | Source |
|---|---|
| 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-4-(hydroxyimino)-3,4-dihydropyrimidin-2(1H)-one | IUPAC |
| 4-N-hydroxycytidine | ChemIDplus |
| 4-oxime uridine | ChemIDplus |
| EIDD 1931 | ChEBI |
| EIDD-1931 | DrugBank |
| N(4)-hydroxycytidine | ChemIDplus |
| Citations |
|---|